| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | BIS(TRIMETHYLSILYL) MALONATE Basic information |
| | BIS(TRIMETHYLSILYL) MALONATE Chemical Properties |
| Melting point | 56 °C | | Boiling point | 63-66 °C/1 mmHg (lit.) | | density | 0.974 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.416(lit.) | | Fp | 75 °F | | storage temp. | 2-8°C | | form | Liquid | | pka | 12.18±0.46(Predicted) | | color | Clear colorless to straw | | Specific Gravity | 0.97 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2212115 | | InChI | 1S/C9H20O4Si2/c1-14(2,3)12-8(10)7-9(11)13-15(4,5)6/h7H2,1-6H3 | | InChIKey | ATCKJLDGNXGLAO-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C | | CAS DataBase Reference | 18457-04-0(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | BIS(TRIMETHYLSILYL) MALONATE Usage And Synthesis |
| Chemical Properties | clear colorless to straw colored liquid | | Uses | Bis(trimethylsilyl) malonate was used as cyclocondensation agent in cyclocondensation reactions. It was also used in the preparation of β-keto acids and methyl ketones. | | General Description | Bis(trimethylsilyl) malonate is precursor for metal-organic chemical vapor deposition (MOCVD) of HfO2 and ZrO2 thin films. It undergoes acylation reaction with acid chlorides and acyl carbonates in the presence of triethylamine and magnesium or lithium salts to give β-keto acids or methyl ketones. | | Synthesis | Bis(trimethylsilyl) Malonate can be easily prepared from malonic acid by a number of silylation procedures. It is a reagent useful in the synthesis of β-keto acids and methyl ketones.
| | References | [1] Tetrahedron, 2016, vol. 72, # 37, p. 5713 - 5723 [2] Canadian Journal of Chemistry, 1972, vol. 50, p. 3913 - 3916 |
| | BIS(TRIMETHYLSILYL) MALONATE Preparation Products And Raw materials |
|