| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Chloro-4-iodoaniline Basic information |
| | 3-Chloro-4-iodoaniline Chemical Properties |
| Melting point | 65-70 °C | | Boiling point | 312.8±27.0 °C(Predicted) | | density | 1.9011 (estimate) | | Fp | 143℃ | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 2.75±0.10(Predicted) | | form | powder to crystal | | color | White to Amber to Dark purple | | Sensitive | Light Sensitive | | BRN | 3236464 | | InChI | InChI=1S/C6H5ClIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 | | InChIKey | ONZHMGRKWJMTDE-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(I)C(Cl)=C1 | | CAS DataBase Reference | 135050-44-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 36/37/39-26 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Chloro-4-iodoaniline Usage And Synthesis |
| Chemical Properties | greyish-green crystalline powder | | Uses | 3-Chloro-4-iodoaniline used as a intermediate for organic syntheses. |
| | 3-Chloro-4-iodoaniline Preparation Products And Raw materials |
|