- 2-CHLORO-6-IODOANILINE
-
- $6.68 / 1KG
-
2020-01-09
- CAS: 84483-28-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 2-CHLORO-6-IODOANILINE Basic information | | Uses |
| Product Name: | 2-CHLORO-6-IODOANILINE | | Synonyms: | 2-Amino-3-chloroiodobenzene;2-CHLORO-6-IODOANILINE;2-Chloro-6-iodoaniline 98+%;Benzenamine, 2-chloro-6-iodo-;2-CHLORO-6-IODOANILINE ISO 9001：2015 REACH | | CAS: | 84483-28-3 | | MF: | C6H5ClIN | | MW: | 253.47 | | EINECS: | | | Product Categories: | | | Mol File: | 84483-28-3.mol |  |
| | 2-CHLORO-6-IODOANILINE Chemical Properties |
| Melting point | 66-67°C | | Boiling point | 273.1±25.0 °C(Predicted) | | density | 2.015±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 0.59±0.10(Predicted) | | form | solid | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C6H5ClIN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 | | InChIKey | UTFIHWOTCWJTGT-UHFFFAOYSA-N | | SMILES | C1(N)=C(I)C=CC=C1Cl |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2921420090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | 2-CHLORO-6-IODOANILINE Usage And Synthesis |
| Uses | 2-Chloro-6-iodoaniline is an aniline derivative that can be used to synthesize drugs with antidepressant, antitumor, and antibacterial properties. |
| | 2-CHLORO-6-IODOANILINE Preparation Products And Raw materials |
|