| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol Basic information |
| Product Name: | (1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol | | Synonyms: | (1S,2S)-3-Methoxy-2-amino-1-phenyl-1-propanol;(1S,2S)-(+)-2-AMino-3-Methoxy-1-phenylpropanol;(1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol 98%;(1S,2S)-(+)-2-Amino-3-methoxy-1-pheny;Benzenemethanol, α-[(1S)-1-amino-2-methoxyethyl]-, (αS)-;(1S,2S)-(+)-2-AMINO-3-METHOXY-1-PHENYL-1-PROPANOL USP/EP/BP;(1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol;(1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol | | CAS: | 51594-34-4 | | MF: | C10H15NO2 | | MW: | 181.23 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 51594-34-4.mol |  |
| | (1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol Chemical Properties |
| Melting point | 51-53 °C(lit.) | | Fp | >230 °F | | form | solid | | Optical Rotation | [α]18/D +25°, c = 10.6 in chloroform | | InChI | 1S/C10H15NO2/c1-13-7-9(11)10(12)8-5-3-2-4-6-8/h2-6,9-10,12H,7,11H2,1H3/t9-,10-/m0/s1 | | InChIKey | SNTCCWUWWYWRLN-UWVGGRQHSA-N | | SMILES | COC[C@H](N)[C@@H](O)c1ccccc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol Usage And Synthesis |
| | (1S,2S)-(+)-2-Amino-3-methoxy-1-phenyl-1-propanol Preparation Products And Raw materials |
|