2,6-Dichloropyridine-4-boronicacid manufacturers
|
| | 2,6-Dichloropyridine-4-boronicacid Basic information |
| Product Name: | 2,6-Dichloropyridine-4-boronicacid | | Synonyms: | 2,6-DICHLOROPYRIDIN-4-YLBORONIC ACID;6-dichloropyridin-4-yl-4-boronic acid;2,6-Dichloropyridine-4-boronicacid;Boronic acid, B-(2,6-dichloro-4-pyridinyl)-;(2,6-Dichloropyridin-4-yl)boronicaci;2,6-Dichloropyridine-4-boronicacid ISO 9001：2015 REACH;(2,6-Dichloro-4-pyridinyl)boronic acid | | CAS: | 1072951-54-2 | | MF: | C5H4BCl2NO2 | | MW: | 191.81 | | EINECS: | | | Product Categories: | | | Mol File: | 1072951-54-2.mol |  |
| | 2,6-Dichloropyridine-4-boronicacid Chemical Properties |
| Boiling point | 396.8±52.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 5.57±0.11(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4BCl2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2,10-11H | | InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N | | SMILES | B(C1C=C(Cl)N=C(Cl)C=1)(O)O | | CAS DataBase Reference | 1072951-54-2 |
| | 2,6-Dichloropyridine-4-boronicacid Usage And Synthesis |
| Chemical Properties | 2,6-Dichloropyridine-4-boronic acid is a white or off-white crystalline powder, insoluble in water but soluble in organic solvents. It has remarkable stability in its chemical structure, which allows it to maintain its original properties in various chemical reactions. In addition, 2,6-dichloropyridine-4-boronic acid is also highly thermally and chemically stable, capable of maintaining its structure and properties at higher temperatures and in more complex chemical environments. | | Uses | 2,6-Dichloropyridine-4-boronic is used in preparation of orally bioavailable GPR40 agonists bearing thiophenylpropanoic acid scaffold for diabetes treatment |
| | 2,6-Dichloropyridine-4-boronicacid Preparation Products And Raw materials |
|