| Company Name: |
Yangzhou Prince Chemical Co., Ltd Gold
|
| Tel: |
0514-84248359 13328140016 |
| Email: |
sales@princechem.com |
| Products Intro: |
Product Name:1-phenylcyclopentane carbonyl chloride
CAS:17380-62-0
Purity:99% Package:0.5KG;1KG;10KG;100KG;1000KG;
|
| Company Name: |
Zouping Mingxing Chemical Co.,Ltd.
|
| Tel: |
86-13605431940 13605431940 |
| Email: |
zpmxchemical@126.com |
| Products Intro: |
Product Name:α-Phenylcyclopentanecarbonyl chloride
CAS:17380-62-0
Purity:99% 98% 95% Package:根据客户具体数量
|
|
| | α-Phenylcyclopentanecarbonyl chloride Basic information |
| Product Name: | α-Phenylcyclopentanecarbonyl chloride | | Synonyms: | 1-Phenylcyclopentane-1-carbonyl chloride;1-Phenylcyclopentanecarboxylic acid chloride;CYCLOPENTANECARBONYL CHLORIDE,1-PHENYL-;α-Phenylcyclopentanecarbonyl chloride;α-Phenylcyclopentanecarbonyl chloride | | CAS: | 17380-62-0 | | MF: | C12H13ClO | | MW: | 208.68 | | EINECS: | | | Product Categories: | | | Mol File: | 17380-62-0.mol |  |
| | α-Phenylcyclopentanecarbonyl chloride Chemical Properties |
| Melting point | 105-107 °C | | Boiling point | 88-90 °C(Press: 0.4 Torr) | | density | 1.175±0.06 g/cm3(Predicted) | | form | solid | | InChI | InChI=1S/C12H13ClO/c13-11(14)12(8-4-5-9-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 | | InChIKey | NOYKUYNVZHTPCI-UHFFFAOYSA-N | | SMILES | C(Cl)(C1(C2=CC=CC=C2)CCCC1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | α-Phenylcyclopentanecarbonyl chloride Usage And Synthesis |
| Chemical Properties | Liquid. Boiling point 149-150℃/2.92kPa. | | Uses | 1-Phenyl-cyclopentanecarbonyl chloride was a useful reactant for the discovery and preparation of piperazinylquinoline derivatives as novel respiratory syncytial virus fusion inhibitors. |
| | α-Phenylcyclopentanecarbonyl chloride Preparation Products And Raw materials |
|