|
|
| | 2-Bromo-5-methylbenzonitrile Basic information |
| | 2-Bromo-5-methylbenzonitrile Chemical Properties |
| Melting point | 61-65 °C | | Boiling point | 290 °C | | density | 1.51 | | Fp | 129 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | Off-white to pale yellow | | InChI | InChI=1S/C8H6BrN/c1-6-2-3-8(9)7(4-6)5-10/h2-4H,1H3 | | InChIKey | AKCXJAVATJLYQM-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(C)=CC=C1Br | | CAS DataBase Reference | 42872-83-3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | 3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Bromo-5-methylbenzonitrile Usage And Synthesis |
| Chemical Properties | off-white crystalline | | Reactions | 2-Bromo-5-methylbenzonitrile is a quinazolinone that can be synthesized by reacting 2-bromotoluene with nitric acid. It is a substrate for the synthesis of other quinazolinones. |
| | 2-Bromo-5-methylbenzonitrile Preparation Products And Raw materials |
|