(4-Benzothiazol-2-yl-phenyl)-dimethyl-amine manufacturers
- Luciferase-IN-1
-
- $37.00
-
2026-08-04
- CAS:10205-56-8
- Purity: 97.84%
- Supply Ability: 10g
|
| | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine Basic information |
| Product Name: | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine | | Synonyms: | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine;2-(4'-Dimethylaminophenyl)benzothiazole;Benzothiazole, 2-(p-(dimethylamino)phenyl)-;Brn 0185488;Benzenamine, 4-(2-benzothiazolyl)-N,N-dimethyl-;Luciferase-IN-1;Luciferase IN 1,LuciferaseIN1;4-(Benzo[d]thiazol-2-yl)-N,N-dimethylaniline | | CAS: | 10205-56-8 | | MF: | C15H14N2S | | MW: | 254.35 | | EINECS: | | | Product Categories: | | | Mol File: | 10205-56-8.mol |  |
| | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO: 0.5mg/mL ethanol: 3mg/mL | | form | Solid | | color | Light yellow to brown | | InChI | 1S/C15H14N2S/c1-17(2)12-9-7-11(8-10-12)15-16-13-5-3-4-6-14(13)18-15/h3-10H,1-2H3 | | InChIKey | HYKGLCSXVAAXNC-UHFFFAOYSA-N | | SMILES | [s]1c2c(nc1c3ccc(cc3)N(C)C)cccc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine Usage And Synthesis |
| Uses | 4-(1,3-Benzothiazol-2-yl)-n,n-dimethylaniline can be used as a pest control agent having juvenile hormone antagonistic activity. |
| | (4-Benzothiazol-2-yl-phenyl)-dimethyl-amine Preparation Products And Raw materials |
|