- 4-aminocyclohexan-1-ol
-
- $1.10
-
2026-08-20
- CAS:56239-26-0
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | cis-4-Aminocyclohexanol hydrochloride Basic information |
| Product Name: | cis-4-Aminocyclohexanol hydrochloride | | Synonyms: | CIS-4-AMINOCYCLOHEXANOL HCL;Cyclohexanol, 4-amino-, hydrochloride, cis-;phenylmethyl 1-(3',4'-dihydroxyphenyl)propenate;rac-cis-4-AMinoc;cis-4-HydroxycyclohexylaMine Hydrochloride;Cyclohexanol, 4-aMino-,hydrochloride (1:1), cis-;rac-cis-4-AMinocyclohexanol Hydrochloride;(1s,4s)-4-aMinocyclohexanol hydrochloride | | CAS: | 56239-26-0 | | MF: | C6H13NO.ClH | | MW: | 151.63 | | EINECS: | 641-607-6 | | Product Categories: | Chiral Reagents;Intermediates;56239-26-0 | | Mol File: | 56239-26-0.mol |  |
| | cis-4-Aminocyclohexanol hydrochloride Chemical Properties |
| Melting point | 193-200℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | Sensitive | Moisture Sensitive | | InChI | InChI=1/C6H13NO.ClH/c7-5-1-3-6(8)4-2-5;/h5-6,8H,1-4,7H2;1H/t5-,6+; | | InChIKey | RKTQEVMZBCBOSB-KNCHESJLNA-N | | SMILES | N[C@@H]1CC[C@H](O)CC1.Cl |&1:1,4,r| | | CAS DataBase Reference | 56239-26-0 |
| | cis-4-Aminocyclohexanol hydrochloride Usage And Synthesis |
| Uses | 4-aminocyclohexan-1-ol is used in the preparation of potential hypertensive agents and other biologically active compounds. |
| | cis-4-Aminocyclohexanol hydrochloride Preparation Products And Raw materials |
|