|
|
| | Imp. D (EP) as hydrochloride: cis-4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol hydrochloride Basic information |
| | Imp. D (EP) as hydrochloride: cis-4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol hydrochloride Chemical Properties |
| InChI | InChI=1/C13H18Br2N2O.ClH/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10;/h5-6,10-11,17-18H,1-4,7,16H2;1H/t10-,11+; | | InChIKey | QNVKOSLOVOTXKF-NJJJQDLFNA-N | | SMILES | C(C1C=C(Br)C=C(Br)C=1N)N[C@@H]1CC[C@H](O)CC1.Cl |&1:11,14,r| |
| | Imp. D (EP) as hydrochloride: cis-4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol hydrochloride Usage And Synthesis |
| Definition | ChEBI: Ambroxol hydrochloride is an aromatic amine. |
| | Imp. D (EP) as hydrochloride: cis-4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol hydrochloride Preparation Products And Raw materials |
|