| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diethyl 4-oxopimelate Basic information |
| Product Name: | Diethyl 4-oxopimelate | | Synonyms: | DIETHYL-GAMMA-OXOPIMELATE;DIETHYL G-KETOPIMELATE;Diethyl 4-oxoheptanedioate;Diethyl gamma-ketopimelate;Heptanedioic acid, 4-oxo-, diethyl ester;4-Oxoheptanedioic acid diethyl ester;4-Oxopimelic acid diethyl;4-Oxoheptanedioc acid diethyl ester | | CAS: | 6317-49-3 | | MF: | C11H18O5 | | MW: | 230.26 | | EINECS: | 228-657-0 | | Product Categories: | | | Mol File: | 6317-49-3.mol |  |
| | Diethyl 4-oxopimelate Chemical Properties |
| Melting point | 58 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) | | Boiling point | 144 °C/0.6 mmHg | | density | 1.073 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | BRN | 1571968 | | InChI | InChI=1S/C11H18O5/c1-3-15-10(13)7-5-9(12)6-8-11(14)16-4-2/h3-8H2,1-2H3 | | InChIKey | ZGBUXZJMZBBISR-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCC(=O)CCC(OCC)=O |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 8-9 | | HazardClass | IRRITANT | | HS Code | 2917198090 | | Storage Class | 10 - Combustible liquids |
| | Diethyl 4-oxopimelate Usage And Synthesis |
| Uses | DIETHYL 4-OXOPIMELATE is a very important chemical raw material. In industrial production, diacids have extremely wide applications; they are intermediates in the manufacture of diesters, polyesters, and polyamides, and are raw materials for the synthesis of lubricants, plasticizers, heat transfer oils, dielectric fluids, fibers, copolymers, inks, coating resins, surfactants, bactericides, insecticides, hot melt coatings, and adhesives. | | Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 3425, 1956 DOI: 10.1021/ja01595a044
Organic Syntheses, Coll. Vol. 4, p. 302, 1963
Tetrahedron Letters, 29, p. 1541, 1988 DOI: 10.1016/S0040-4039(00)80346-9 |
| | Diethyl 4-oxopimelate Preparation Products And Raw materials |
|