| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (-)-Diisopropyl-L-malate Basic information |
| | (-)-Diisopropyl-L-malate Chemical Properties |
| Boiling point | 237 °C(lit.) | | density | 1.055 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.43(lit.) | | Fp | >230 °F | | form | liquid | | pka | 12.446±0.20(predicted) | | color | Colourless | | Optical Rotation | [α]20/D 13°, neat | | InChI | 1S/C10H18O5/c1-6(2)14-9(12)5-8(11)10(13)15-7(3)4/h6-8,11H,5H2,1-4H3/t8-/m0/s1 | | InChIKey | XYVHRFVONMVDGK-QMMMGPOBSA-N | | SMILES | CC(C)OC(=O)C[C@H](O)C(=O)OC(C)C | | CAS DataBase Reference | 83541-68-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2918199890 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (-)-Diisopropyl-L-malate Usage And Synthesis |
| Uses | Diisopropyl (S)-()-malate can be used as a starting material in the total synthesis of ()-wikstromol, an α-hydroxylated lactone lignan found in Asian medicinal plants. |
| | (-)-Diisopropyl-L-malate Preparation Products And Raw materials |
|