- Isobavachin
-
- $34.00
-
2026-08-04
- CAS:31524-62-6
- Purity: 99.21%
- Supply Ability: 10g
- sobavachin
-
-
2026-06-30
- CAS:31524-62-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20Tons
- Isobavachin
-
-
2023-02-24
- CAS:31524-62-6
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Isobavachin Basic information |
| Product Name: | Isobavachin | | Synonyms: | Isobavachin;(2S)-2,3-Dihydro-7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)- 4H-1-benzopyran-4-one;(S)-2,3-Dihydro-7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one;(S)-Isobavachin;Isobavachin USP/EP/BP;(2S)-7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)...;4-Dihydro-1-phenylisoquinoline;(S)-7-Hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)chroman-4-one | | CAS: | 31524-62-6 | | MF: | C20H20O4 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 31524-62-6.mol |  |
| | Isobavachin Chemical Properties |
| Melting point | 187-188℃ | | density | 1.244 | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | Off-white to light yellow | | SMILES | OC1=CC=C(C(CC(C2=CC=C(O)C=C2)O3)=O)C3=C1CC=C(C)C | | CAS DataBase Reference | 31524-62-6 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | Isobavachin Usage And Synthesis |
| Chemical Properties | Soluble in organic solvents such as methanol, ethanol, and DMSO. | | Uses | Flavonoids is the parent compound for I315240. Flavonoids are ant-idiabetic activity, most of the flavonoids showed a remarkable in vitro activity. | | Definition | ChEBI: Isobavachin is a member of flavanones. |
| | Isobavachin Preparation Products And Raw materials |
|