| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-(4-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid Basic information |
| Product Name: | 2-(4-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid | | Synonyms: | 4-Methyl-2-(3-methoxyphenyl)thiazole-5-carboxylicacid;2-(4-Methoxyphenyl)-4-Methylthiazole-5-carboxylic acid, 97%;2-(4-methoxyphenyl)-4-methyl-5-thiazolecarboxylic acid;5-Thiazolecarboxylic acid, 2-(4-methoxyphenyl)-4-methyl-;2-(4-Methoxyphenyl)-4-methylthiazole-5-carboxylicacid,97%;2-(4-Methoxyphenyl)-4-methylthiazole-5-carboxylic Acid;2-(4-Methoxyphenyl)-4-methylthiazole-5-carboxylic aci | | CAS: | 54001-16-0 | | MF: | C12H11NO3S | | MW: | 249.29 | | EINECS: | | | Product Categories: | | | Mol File: | 54001-16-0.mol |  |
| | 2-(4-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 236-241℃ | | Boiling point | 454.219±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.310±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | pka | 1.323±0.37(predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C12H11NO3S/c1-7-10(12(14)15)17-11(13-7)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,14,15) | | InChIKey | HWHHZTHVYFDJNK-UHFFFAOYSA-N | | SMILES | [s]1c(nc(c1C(=O)O)C)c2ccc(cc2)OC | | CAS DataBase Reference | 54001-16-0 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(4-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| | 2-(4-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|