|
|
| | 4-BROMO-6-CHLORO-1H-INDAZOLE Basic information |
| | 4-BROMO-6-CHLORO-1H-INDAZOLE Chemical Properties |
| Melting point | 219-221° | | Boiling point | 364.1±22.0 °C(Predicted) | | density | 1.878 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 11.60±0.40(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C7H4BrClN2/c8-6-1-4(9)2-7-5(6)3-10-11-7/h1-3H,(H,10,11) | | InChIKey | KCDKINCUTSIQAF-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC(Cl)=C2)C=N1 | | CAS DataBase Reference | 885519-03-9 |
| | 4-BROMO-6-CHLORO-1H-INDAZOLE Usage And Synthesis |
| Synthesis | 4-Bromo-6-chloro-1H-indazole is an intermediate used in the preparation of formaldoxime and hydrazine. It is prepared by diazotizing 4-chloro-2-fluoroaniline with sodium nitrite and nitrite. The product can be purified by recrystallization from water or ethanol. |
| | 4-BROMO-6-CHLORO-1H-INDAZOLE Preparation Products And Raw materials |
|