|
|
| | 6-(Trifluoromethyl)-4-bromo indazole Basic information |
| Product Name: | 6-(Trifluoromethyl)-4-bromo indazole | | Synonyms: | 4-BROMO-6-TRIFLUOROMETHYL-1H-INDAZOLE;1H-Indazole,4-broMo-6-(trifluoroMethyl)-;4-BroMo-6-trifluoroMethyl-indazole;4-Bromo-6-(trifluoromethyl);4-bromo-6-(trifluoromethyl)-2H-indazole;6-(Trifluoromethyl)-4-bromo indazole | | CAS: | 1000342-95-9 | | MF: | C8H4BrF3N2 | | MW: | 265.03 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 6-(Trifluoromethyl)-4-bromo indazole Chemical Properties |
| Boiling point | 309.2±37.0 °C(Predicted) | | density | 1.830±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 10.94±0.40(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H4BrF3N2/c9-6-1-4(8(10,11)12)2-7-5(6)3-13-14-7/h1-3H,(H,13,14) | | InChIKey | JRUCLQINUHVRJW-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC(C(F)(F)F)=C2)C=N1 |
| | 6-(Trifluoromethyl)-4-bromo indazole Usage And Synthesis |
| Uses | 6-(TRIFLUOROMETHYL)-4-BROMO INDAZOLE is used as a chemical intermediate
for the synthesis of various pharmaceuticals. |
| | 6-(Trifluoromethyl)-4-bromo indazole Preparation Products And Raw materials |
|