- 2,6-Dichloronicotinic acid
-
- $6.00 / 1KG
-
2025-09-25
- CAS:38496-18-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Dichloronicotinic acid Basic information |
| Product Name: | 2,6-Dichloronicotinic acid | | Synonyms: | 2,6-Dichloropyridine-3-carboxylic acid, 3-Carboxy-2,6-dichloropyridine;2,6- twochlorine nicotinic acid;2,6-dichloro-3-carboxypyridine;3-Pyridinecarboxylic acid, 2,6-dichloro-;132453;2,6-DICHLOROPYRIDINE-3-CARBOXYLIC ACID;2,6-DICHLORONICOTINIC ACID;2,6-DICHLORONICOTININC ACID | | CAS: | 38496-18-3 | | MF: | C6H3Cl2NO2 | | MW: | 192 | | EINECS: | 609-561-1 | | Product Categories: | alkyl chloride|carboxylic acid;C6 to C7;Chemical Synthesis;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyridines, Pyrimidines, Purines and Pteredines;pyridine derivative;Acids and Derivatives;Heterocycles;Heterocyclic Compounds;Chloropyridines;Halopyridines;pharmacetical;Carboxylic Acids;Pyridines;Pyridine;Organic acids;Pyridines derivates;Building Blocks;C5 to C6;Inhibitors;Nicotine Derivatives;Carboxylic Acids | | Mol File: | 38496-18-3.mol |  |
| | 2,6-Dichloronicotinic acid Chemical Properties |
| Melting point | 140-143 °C(lit.) | | Boiling point | 351.2±37.0 °C(Predicted) | | density | 1.612±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | pka | 1.77±0.28(Predicted) | | form | Crystalline Powder | | color | Off-white or pale yellow | | BRN | 136114 | | InChI | InChI=1S/C6H3Cl2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11) | | InChIKey | AJPKQSSFYHPYMH-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC=C1C(O)=O | | CAS DataBase Reference | 38496-18-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Dichloronicotinic acid Usage And Synthesis |
| Chemical Properties | Off-white toyellow soli | | Uses | 2,6-Dichloronicotinic acid is used for preparation of pyridine derivatives as inhibitors of human 11β hydroxysteroid dehydrogenase type 1 enzyme. | | Uses | Used for preparation of pyridine derivatives as inhibitors of human 11β hydroxysteroid dehydrogenase type 1 enzyme. | | Definition | ChEBI: 2,6-Dichloronicotinic acid is an aromatic carboxylic acid and a member of pyridines. |
| | 2,6-Dichloronicotinic acid Preparation Products And Raw materials |
|