|
|
| | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid Basic information |
| Product Name: | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid | | Synonyms: | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid;trans-4-[(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid;Cyclohexanecarboxylic acid, 4-[(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)Methyl]-, trans-;trans-4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)Methyl)cyclohexanecarboxylic acid;trans-4-(N-maleimidemethyl)cyclohexane-1-carboxylic acid;trans-4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl);(1R,4R)-4-((2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)METHYL)CYCLOHEXANECARBOXYLIC ACID;trans-4-(N-Maleimidomethyl)cyclohexane-1-carboxylic Acid | | CAS: | 69907-67-1 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 69907-67-1.mol |  |
| | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid Chemical Properties |
| Melting point | 144 °C(Solv: benzene (71-43-2)) | | Boiling point | 433.6±18.0 °C(Predicted) | | density | 1.329 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.80±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17)/t8-,9- | | InChIKey | LQILVUYCDHSGEU-KYZUINATSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](CN2C(=O)C=CC2=O)CC1 | | CAS DataBase Reference | 69907-67-1 |
| | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid Usage And Synthesis |
| Description | Trans-4-(Maleimidomethyl) cyclohexanecarboxylic Acid is a kind of carboxylate, being well known for its N-hydroxysuccinimide ester derivative (SMCC), which is a useful cross-linking reagent. SMCC is widely used for the generation of stable maleimide-activated carrier proteins, enzyme immunoconjugates and hapten carrier molecule conjugates. It can be used for the coupling of a peptide to an amino group. | | Synthesis | Step B: Maleamic acid (36.8 g, 144 mmol) and sodium acetate (13.6 g, 165 mmol) prepared in Step A were dissolved in acetic anhydride (368 mL), and the mixture was transferred to a sealed glass reaction vessel and heated to react for 3 hours at 120 °C. Upon completion of the reaction, the cooled black slurry reaction mixture was slowly poured into water (3 L), stirred thoroughly and extracted with dichloromethane. The organic layers were combined, dried with anhydrous sodium sulfate, filtered through a sintered glass funnel, and the filtrate was evaporated to dryness and dried under high vacuum to afford the target product trans-4-(maleimidomethyl)cyclohexanecarboxylic acid as a yellow solid (7.00 g, 20% yield). The product was characterized by 1H NMR (300 MHz, CDCl3): δ 6.73 (s, 2H), 3.40 (d, 2H, J = 7 Hz), 2.28 (m, 1H), 2.06 (m, 2H), 1.75 (m, 3H), 1.42 (m, 2H), 1.03 (m, 2H). | | References | https://www.aatbio.com/products/smcc-4-n-maleimidomethyl-cyclohexanecarboxylic-acid-n-hydroxysuccinimide-ester-cas-64987-85-5
http://www.sigmaaldrich.com/catalog/product/sigma/m5525lang=en®ion=US
Zhang, Hongyan, et al. "Antifreeze protein detection using Rhodamine B as photoluminescence label inporous silicon." Current Applied Physics13.4(2013):736-742. |
| | Trans-4-(Maleimidomethyl)cyclohexanecarboxylic Acid Preparation Products And Raw materials |
|