|
|
| | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester Basic information |
| Product Name: | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester | | Synonyms: | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester;1-tert-butyl 4-ethyl 4-allylpiperidine-1,4-dicarboxylate;1-(1,1-Dimethylethyl) 4-ethyl 4-(2-propenyl)-1,4-piperidinedicarboxylate;Ethyl 4-allyl-1-(tert-butoxycarbonyl)piperidine-4-carboxylate;1-Boc-4-allyl-4-ethoxycarbonylpiperidine;1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-;4-Allylpiperidine-1,4-dicarboxylic acid;4-Allyl-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-ethyl ester | | CAS: | 146603-99-8 | | MF: | C16H27NO4 | | MW: | 297.39 | | EINECS: | | | Product Categories: | Building Blocks;C16 to C36;Chemical Synthesis;Heterocyclic Building Blocks;Piperidines | | Mol File: | 146603-99-8.mol |  |
| | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester Chemical Properties |
| Boiling point | 130-135℃/1.5mmHg | | density | 1.020g/mLat 25℃ | | refractive index | n20/D 1.4676 | | Fp | >110°C | | storage temp. | Store at Room Tem. | | pka | -2.29±0.40(Predicted) | | form | solid | | InChI | 1S/C16H27NO4/c1-6-8-16(13(18)20-7-2)9-11-17(12-10-16)14(19)21-15(3,4)5/h6H,1,7-12H2,2-5H3 | | InChIKey | FOOVEGXEARQUBR-UHFFFAOYSA-N | | SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CC=C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester Usage And Synthesis |
| Uses | Reactant for synthesis of T-type calcium channel antagonists1 | | Uses | Ethyl 1-Boc-4-allyl-4-piperidinecarboxylate is an intermediate used in the synthesis of 2,8-diazaspiro[4.5]decanones as T-type calcium channel antagonists. |
| | 1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester Preparation Products And Raw materials |
|