|
|
| | Amlodipine EP Impurity D Basic information |
| Product Name: | Amlodipine EP Impurity D | | Synonyms: | 2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic Acid 3-Ethyl 5-Methyl Ester;3-Ethyl 5-Methyl Ester 2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methylpyridine-3,5-dicarboxylate;Dehydro Amlodipine (Amlodipine Impurity D);2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic Acid 3-Ethyl 5-Methyl Ester Oxalate;Dehydro Amlodipine Oxalate;3-Ethyl, 5-Methyl [2-(2-aMinoethoxyMethyl)-4-(2-chlorophenyl)-6-Methyl-3,5-pyridinedicarboxylate] fuMarate;Dehydro Amlodipine;UK 55-410 | | CAS: | 113994-41-5 | | MF: | C20H23ClN2O5 | | MW: | 406.86 | | EINECS: | | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Chemical Impurities;DCP | | Mol File: | 113994-41-5.mol |  |
| | Amlodipine EP Impurity D Chemical Properties |
| Melting point | 106-108°C | | Boiling point | 517.9±50.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 8.42±0.10(Predicted) | | form | Oil | | color | Colourless to Pale Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C20H23ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8H,4,9-11,22H2,1-3H3 | | InChIKey | APZSGEHAFPIYQZ-UHFFFAOYSA-N | | SMILES | C1(COCCN)=NC(C)=C(C(OC)=O)C(C2=CC=CC=C2Cl)=C1C(OCC)=O | | CAS DataBase Reference | 113994-41-5 |
| | Amlodipine EP Impurity D Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Amlodipine impurity D | | Uses | Dehydro Amlodipine is an Amlodipine (A633495) impurity. | | Uses | Dehydro Amlodipine (Amlodipine Besylate EP Impurity D) is an Amlodipine (A633495) impurity. | | Synthesis |
Amlodipine EP impurity D can be prepared from amlodipine by dehydroxylation in the presence of a suitable oxidizing agent.
|
| | Amlodipine EP Impurity D Preparation Products And Raw materials |
|