| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(2-Bromophenyl)-2-thiourea Basic information |
| | 1-(2-Bromophenyl)-2-thiourea Chemical Properties |
| Melting point | 125-129 °C(lit.) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | BRN | 2718427 | | InChI | InChI=1S/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) | | InChIKey | QIGMVYSPXPXCPN-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC=C1Br)C(N)=S | | CAS DataBase Reference | 5391-30-0(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25-38-43 | | Safety Statements | 22-28-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Skin Irrit. 2
Skin Sens. 1 |
| | 1-(2-Bromophenyl)-2-thiourea Usage And Synthesis |
| Definition | ChEBI: (2-bromophenyl)thiourea is a member of thioureas. |
| | 1-(2-Bromophenyl)-2-thiourea Preparation Products And Raw materials |
|