| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(3R)-(?)-3-(1-Methyl-1H-indol-3-yl)butyraldehyde CAS:405873-05-4 Purity:98% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(3R)-(-)-3-(1-Methyl-1H-indol-3-yl)butyraldehyde CAS:405873-05-4 Purity:98% Package:1G Remarks:591882-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(3R)-()-3-(1-Methyl-1H-indol-3-yl)butyraldehyde CAS:405873-05-4
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:(3R)-(-)-3-(1-Methyl-1H-indol-3-yl)butyraldehyde CAS:405873-05-4
|
|
| | (3R)-(-)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE Basic information |
| | (3R)-(-)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE Chemical Properties |
| Melting point | 55.5-59.5 °C (lit.) | | Optical Rotation | [α]20/D -6, c = 1% in chloroform | | InChI | 1S/C13H15NO/c1-10(7-8-15)12-9-14(2)13-6-4-3-5-11(12)13/h3-6,8-10H,7H2,1-2H3/t10-/m1/s1 | | InChIKey | OQWWHYBHQFZHLP-SNVBAGLBSA-N | | SMILES | C[C@H](CC=O)c1cn(C)c2ccccc12 |
| Hazard Codes | Xn,T | | Risk Statements | 22-37/38-41-42/43-36/37/38-25 | | Safety Statements | 26-36-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (3R)-(-)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE Usage And Synthesis |
| Uses | (3R)-()-3-(1-Methyl-1H-indol-3-yl)butyraldehyde can be used as a substrate in the synthesis of 2-alkyl cyclohexanone intermediates, applicable in the preparation of tricyclic steroid precursors.
|
| | (3R)-(-)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE Preparation Products And Raw materials |
|