| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-Methyl-3-(1-methyl-1H-indol-3-yl)-phenyl-propionate Basic information |
| | (S)-Methyl-3-(1-methyl-1H-indol-3-yl)-phenyl-propionate Chemical Properties |
| Melting point | 89-93 °C (lit.) | | Boiling point | 442.9±30.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | form | solid | | Optical Rotation | [α]20/D +36°, c = 1% in chloroform | | InChI | 1S/C19H19NO2/c1-20-13-17(15-10-6-7-11-18(15)20)16(12-19(21)22-2)14-8-4-3-5-9-14/h3-11,13,16H,12H2,1-2H3/t16-/m0/s1 | | InChIKey | NFIUVSIKIXOXQK-INIZCTEOSA-N | | SMILES | COC(=O)C[C@@H](c1ccccc1)c2cn(C)c3ccccc23 |
| Hazard Codes | Xn | | Risk Statements | 36-42/43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | (S)-Methyl-3-(1-methyl-1H-indol-3-yl)-phenyl-propionate Usage And Synthesis |
| | (S)-Methyl-3-(1-methyl-1H-indol-3-yl)-phenyl-propionate Preparation Products And Raw materials |
|