ETHYL 4-ACETYL-5-OXOHEXANOATE manufacturers
|
| | ETHYL 4-ACETYL-5-OXOHEXANOATE Basic information |
| | ETHYL 4-ACETYL-5-OXOHEXANOATE Chemical Properties |
| Boiling point | 153-154 °C/19 mmHg (lit.) | | density | 1.067 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.457(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | pka | 10.17±0.59(Predicted) | | form | clear liquid | | color | Light orange to Yellow to Green | | BRN | 1785189 | | InChI | 1S/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h9H,4-6H2,1-3H3 | | InChIKey | YRSGDLIATOURQO-UHFFFAOYSA-N | | SMILES | CCOC(=O)CCC(C(C)=O)C(C)=O | | CAS DataBase Reference | 2832-10-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2918.30.9000 | | Storage Class | 10 - Combustible liquids |
| | ETHYL 4-ACETYL-5-OXOHEXANOATE Usage And Synthesis |
| Chemical Properties | Clear yellow liquid | | Uses | Ethyl 4-acetyl-5-oxohexanoate was used in synthesis of:
- curcumin analogs having a long linker
- [7-(4-hydroxy-3-methoxyphenyl)-4-[3-(4-hydroxy-3-methoxyphenyl)acryloyl]-5-oxohepta-4,6-dienoic acid ethyl ester], having potential antiandrogenic activity
- [7-(4-hydroxy-3-methoxyphenyl)-4-[3-(4-hydroxy-3-methoxyphenyl)acryloyl]5-oxohepta-4,6-dienoic acid], having potential antiandrogenic activity
| | Synthesis Reference(s) | Synthesis, p. 1062, 1990 DOI: 10.1055/s-1990-27094 |
| | ETHYL 4-ACETYL-5-OXOHEXANOATE Preparation Products And Raw materials |
|