|
|
| | 2-ethyl-1,3-dioxoisoindoline-5-carboxylic acid Basic information |
| | 2-ethyl-1,3-dioxoisoindoline-5-carboxylic acid Chemical Properties |
| Boiling point | 426.3±28.0 °C(Predicted) | | density | 1.435±0.06 g/cm3(Predicted) | | pka | 3.35±0.20(Predicted) | | form | solid | | InChI | 1S/C11H9NO4/c1-2-12-9(13)7-4-3-6(11(15)16)5-8(7)10(12)14/h3-5H,2H2,1H3,(H,15,16) | | InChIKey | FMHDMAFJLDZEKG-UHFFFAOYSA-N | | SMILES | CCN1C(=O)c2ccc(cc2C1=O)C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-ethyl-1,3-dioxoisoindoline-5-carboxylic acid Usage And Synthesis |
| | 2-ethyl-1,3-dioxoisoindoline-5-carboxylic acid Preparation Products And Raw materials |
|