|
|
| | 2-Isobutyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Basic information |
| | 2-Isobutyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C13H13NO4/c1-7(2)6-14-11(15)9-4-3-8(13(17)18)5-10(9)12(14)16/h3-5,7H,6H2,1-2H3,(H,17,18) | | InChIKey | AAOFNSJIPAZHQD-UHFFFAOYSA-N | | SMILES | N1(C(=O)c2c(ccc(c2)C(=O)O)C1=O)CC(C)C |
| Risk Statements | 43 | | Safety Statements | 36/37 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 2-Isobutyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Usage And Synthesis |
| | 2-Isobutyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Preparation Products And Raw materials |
|