|
|
| | 2-Hydroxyethylflurazepam-d4 Basic information |
| Product Name: | 2-Hydroxyethylflurazepam-d4 | | Synonyms: | 2-Hydroxyethylflurazepam-d4 solution;2-Hydroxyethylflurazepam-d4 (CRM);2-Hydroxyethylflurazepam-D4 0.1 mg/ml in Methanol;2-Hydroxyethylflurazepam-d4 | | CAS: | 1397209-35-6 | | MF: | C17H14ClFN2O2 | | MW: | 332.76 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Hydroxyethylflurazepam-d4 Chemical Properties |
| Fp | 9℃ | | storage temp. | 2-8°C | | form | liquid | | Major Application | clinical testing | | InChI | 1S/C17H14ClFN2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)20-10-16(23)21(15)7-8-22/h1-6,9,22H,7-8,10H2/i1D,2D,3D,4D | | InChIKey | FOCBRQQHNOKOJQ-RHQRLBAQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c(F)c1[2H])C2=NCC(=O)N(CCO)c3ccc(Cl)cc23 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 2-Hydroxyethylflurazepam-d4 Usage And Synthesis |
| Description | 2-Hydroxyethylflurazepam-d4 (CRM) (Item No. 40619) is intended for use as an internal standard for the quantification of 2-hydroxyethylflurazepam (Item No. 40185) by GC- or LC-MS. 2-Hydroxyethylflurazepam is categorized as a benzodiazepine metabolite.1 It is a metabolite of flurazepam (Item Nos. 18160 | 16190). This product is intended for research and forensic applications.WARNING This product is not for human or veterinary use. |
| | 2-Hydroxyethylflurazepam-d4 Preparation Products And Raw materials |
|