| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 17ALPHA(H)-22,29,30-TRISNORHOPANE Basic information |
| Product Name: | 17ALPHA(H)-22,29,30-TRISNORHOPANE | | Synonyms: | 17alpha(H)-22,29,30-Trisnorhopane solution;17α(H)-22,29,30-Trisnor-Aμ-neogammacerane;17α(H)-22,29,30-Trisnorhopan solution;17α(H)-22,29,30-Trisnorhopane;17ALPHA(H)-22,29,30-TRISNORHOPANE;A'-Neo-22,29,30-trinorgammacerane, (17α)-;17α(H)-22,29,30-Trisnorhopane in isooctane;17α(H)-22,29,30-Trisnorhopane 10 μg/mL in isooctane | | CAS: | 53584-59-1 | | MF: | C27H46 | | MW: | 370.65 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 53584-59-1.mol |  |
| | 17ALPHA(H)-22,29,30-TRISNORHOPANE Chemical Properties |
| Boiling point | 424.4±12.0 °C(Predicted) | | density | 0.940±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | Major Application | food and beverages | | InChI | 1S/C27H46/c1-23(2)14-8-16-25(4)20(23)13-18-27(6)22(25)11-10-21-24(3)15-7-9-19(24)12-17-26(21,27)5/h19-22H,7-18H2,1-6H3 | | InChIKey | WPKYQECPNNWDJY-UHFFFAOYSA-N | | SMILES | [H][C@@]12CCC[C@]1(C)C3CCC4[C@@]5(C)CCCC(C)(C)C5CC[C@@]4(C)[C@]3(C)CC2 | | EPA Substance Registry System | A'-Neo-22,29,30-trinorgammacerane, (17.alpha.)- (53584-59-1) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 17ALPHA(H)-22,29,30-TRISNORHOPANE Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | 17ALPHA(H)-22,29,30-TRISNORHOPANE Preparation Products And Raw materials |
|