| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N,N'-Ethylenebisacrylamide Basic information |
| Product Name: | N,N'-Ethylenebisacrylamide | | Synonyms: | N,N'-DIACRYLOYLETHYLENEDIAMINE;N-(2-ACRYLOYLAMINO-ETHYL)-ACRYLAMIDE;TECH. 90-95%;N,N’-Bis(acryloyl)-1,2-diaminoethane, (N,N’-Ethylenebis(acrylamide);N,Nμ-Dimethylenebis(acrylamide), N,Nμ-Bisacryloyl-1,2-diaminoethane;N-(2-acrylamidoethyl)acrylamide;N-[2-(prop-2-enoylamino)ethyl]prop-2-enamide;N,N'-Bisacryloylethylenediamine | | CAS: | 2956-58-3 | | MF: | C8H12N2O2 | | MW: | 168.19 | | EINECS: | | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 2956-58-3.mol |  |
| | N,N'-Ethylenebisacrylamide Chemical Properties |
| Melting point | 138-140 °C(lit.) | | Boiling point | 456.3±41.0 °C(Predicted) | | density | 1.034 | | storage temp. | 2-8°C | | pka | 14.07±0.46(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in water and methanol. | | Sensitive | Hygroscopic | | BRN | 1771570 | | InChI | InChI=1S/C8H12N2O2/c1-3-7(11)9-5-6-10-8(12)4-2/h3-4H,1-2,5-6H2,(H,9,11)(H,10,12) | | InChIKey | AYGYHGXUJBFUJU-UHFFFAOYSA-N | | SMILES | C(NC(=O)C=C)CNC(=O)C=C | | CAS DataBase Reference | 2956-58-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 36/37/38-40-11 | | Safety Statements | 26-36/37/39-20 | | RIDADR | 1325 | | WGK Germany | 3 | | F | 10 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N'-Ethylenebisacrylamide Usage And Synthesis |
| Chemical Properties | White to off-white to light red solid | | Uses | N,N'-Ethylenebisacrylamide is used in the preparation of N,N'-dicinnamoyl-ethylendiamine using poly(N-octadecylacrylamide) as a catalyst. It is also used as an intermediate in pharmaceutical industries. |
| | N,N'-Ethylenebisacrylamide Preparation Products And Raw materials |
|