|
|
| | 1,4-Diacryloylpiperazine Basic information |
| Product Name: | 1,4-Diacryloylpiperazine | | Synonyms: | DIACRYLYL-PIPERAZINE;1,4-BIS(ACRYLOYL)PIPERAZINE;1,4-DIACRYLYLPIPERAZINE;Diacrylylpiperazineelectrophoresisgrade;2-Propenoic acid, compd. with piperazine (2:1);ANTI-REA (PHB2)(N-TERMINAL) antibody produced in rabbit;B-cell receptor-associated protein BAP37;PHB2 | | CAS: | 61133-53-7 | | MF: | C10H14N2O2 | | MW: | 194.23 | | EINECS: | | | Product Categories: | | | Mol File: | 61133-53-7.mol |  |
| | 1,4-Diacryloylpiperazine Chemical Properties |
| Melting point | 91.5-93.5 °C(lit.) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H14N2O2/c1-3-9(13)11-5-7-12(8-6-11)10(14)4-2/h3-4H,1-2,5-8H2 | | InChIKey | YERHJBPPDGHCRJ-UHFFFAOYSA-N | | SMILES | N1(CCN(C(=O)C=C)CC1)C(=O)C=C |
| | 1,4-Diacryloylpiperazine Usage And Synthesis |
| Uses | Used as a crosslinker in polyacrylamide gels. PIP provides polyacrylamide gels with increased physical strength and improved separation and detection of proteins. | | Definition | ChEBI: 1-[4-(1-oxoprop-2-enyl)-1-piperazinyl]-2-propen-1-one is a N-acylpiperazine and a tertiary carboxamide. |
| | 1,4-Diacryloylpiperazine Preparation Products And Raw materials |
|