|
|
| | 2-Bromomandelic acid Basic information |
| Product Name: | 2-Bromomandelic acid | | Synonyms: | (R)-2-Bromomandelic;(2R)-Hydroxy(2-bromophenyl)aceticacid;(R)-2-BROMOMANDELIC ACID;Benzeneacetic acid, 2-bromo-α-hydroxy-;(2-Bromo-phenyl)-hydroxy-acetic acid;2-Bromo-α-hydroxybenzeneacetic acid;2-(2-BroMophenyl)-2-hydroxyacetic acid;2-Bromomandelic acid | | CAS: | 7157-15-5 | | MF: | C8H7BrO3 | | MW: | 231.04 | | EINECS: | | | Product Categories: | | | Mol File: | 7157-15-5.mol |  |
| | 2-Bromomandelic acid Chemical Properties |
| Melting point | 89.05 °C | | Boiling point | 383.987±27.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.759±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 3.3 | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7BrO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7,10H,(H,11,12) | | InChIKey | YBNMJUAXERDNRJ-UHFFFAOYSA-N | | SMILES | C1C=C(C(O)C(=O)O)C(Br)=CC=1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 2-Bromomandelic acid Usage And Synthesis |
| Uses | 2-Bromomandelic Acid can be useful in novel in-situ strategy for enantiomeric discrimination and selective identification of multicomponent carboxylic acids in foods. |
| | 2-Bromomandelic acid Preparation Products And Raw materials |
|