| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 2-Bromophenylacetic acid Chemical Properties |
| Melting point | 104-106 °C(lit.) | | Boiling point | 252.95°C (rough estimate) | | density | 1.5313 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Very faint turbidity in methanol. | | pka | pK1: 4.054 (25°C) | | form | Crystalline Powder, Crystals and/or Chunks | | color | White to light beige | | BRN | 2250655 | | InChI | InChI=1S/C8H7BrO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) | | InChIKey | DWXSYDKEWORWBT-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1Br | | CAS DataBase Reference | 18698-97-0(CAS DataBase Reference) | | EPA Substance Registry System | 2-Bromophenylacetic acid (18698-97-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromophenylacetic acid Usage And Synthesis |
| Preparation | 2-Bromophenylacetic acid can be produced by removing the sulfonic acid group through the bromination of p-sulfonophenylacetic acid and the hydrolysis of 2-bromo-4-sulfonophenylacetic acid. | | Chemical Properties | almost white to light beige crystals or powder | | Uses | Employed as a pharmaceutical intermediate. It is also used in organic synthesis. | | Uses | 2-Bromophenylacetic acid has been used:
- as starting reagent in the synthesis of 8-methoxy-2-tetralone
- in the preparation of di-and tri-substituted 2-oxopiperazines on solid support
| | Synthesis Reference(s) | The Journal of Organic Chemistry, 49, p. 4226, 1984 DOI: 10.1021/jo00196a024 |
| | 2-Bromophenylacetic acid Preparation Products And Raw materials |
|