|
|
| | 4-(4-Nitrophenyl)butyric acid Basic information |
| | 4-(4-Nitrophenyl)butyric acid Chemical Properties |
| Melting point | 90-93 °C (lit.) | | Boiling point | 393.8±17.0 °C(Predicted) | | density | 1.293±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 4.68±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | BRN | 2051992 | | InChI | InChI=1S/C10H11NO4/c12-10(13)3-1-2-8-4-6-9(7-5-8)11(14)15/h4-7H,1-3H2,(H,12,13) | | InChIKey | WQMLUHZFRFCQDB-UHFFFAOYSA-N | | SMILES | C1(CCCC(O)=O)=CC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 5600-62-4(CAS DataBase Reference) | | NIST Chemistry Reference | 4-(4-Nitrophenyl)butyric acid(5600-62-4) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2921490090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(4-Nitrophenyl)butyric acid Usage And Synthesis |
| | 4-(4-Nitrophenyl)butyric acid Preparation Products And Raw materials |
|