|
|
| | AC-DL-PHE-BETA-NAPHTHYL ESTER Basic information |
| Product Name: | AC-DL-PHE-BETA-NAPHTHYL ESTER | | Synonyms: | ACETYL-DL-PHE-BETA-NAPHTHYL ESTER;ACETYL-DL-PHENYLALANINE BETA-NAPHTHYL ESTER;ACETYL-DL-PHENYLALANINE-B-NAPHTHYL ESTER;AC-DL-PHENYLALANINE-BETA-NAPHTHYL ESTER;AC-DL-PHE-BETA-NAPHTHYL ESTER;N-acetyl-dl-phenylalanine-B-*naphthyl ester;n-acetyl-dl-phenylalanine β-naphthyl ester;N-acetylphenylalanine beta-naphthyl ester | | CAS: | 20874-31-1 | | MF: | C21H19NO3 | | MW: | 333.38 | | EINECS: | | | Product Categories: | A - H;Amino Acids;Modified Amino Acids | | Mol File: | 20874-31-1.mol |  |
| | AC-DL-PHE-BETA-NAPHTHYL ESTER Chemical Properties |
| Boiling point | 589.8±50.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 14.57±0.46(Predicted) | | color | white | | InChI | 1S/C21H19NO3/c1-15(23)22-20(13-16-7-3-2-4-8-16)21(24)25-19-12-11-17-9-5-6-10-18(17)14-19/h2-12,14,20H,13H2,1H3,(H,22,23) | | InChIKey | BBXRRTJNJCPGBU-UHFFFAOYSA-N | | SMILES | CC(=O)NC(Cc1ccccc1)C(=O)Oc2ccc3ccccc3c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-DL-PHE-BETA-NAPHTHYL ESTER Usage And Synthesis |
| Uses | Acetyl-DL-phenylalanine β-Naphthyl Ester is an aromatic amino acid ester, which functions as a chromogenic substrate for chymotrypsin and microbial serine proteases such as subtilisin. | | Definition | ChEBI: An alpha-amino acid ester obtained by the fromal condensation of N-acetylphenylalanine with 2-naphthol. | | Biological Activity | N-Acetyl-DL-phenylalanine β-naphthyl ester (NAPBNE), a chromogenic substrate, is used to identify, differentiate and characterize serine protease(s) and peptidase(s). |
| | AC-DL-PHE-BETA-NAPHTHYL ESTER Preparation Products And Raw materials |
|