- Z-Glu-OMe
-
-
2025-04-04
- CAS:5672-83-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
- Z-GLU-OME
-
- $1.00
-
2019-07-06
- CAS:5672-83-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- Z-GLU-OME
-
- $7.00
-
2019-07-06
- CAS:5672-83-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Z-GLU-OME Basic information |
| | Z-GLU-OME Chemical Properties |
| Melting point | 68-70 °C(lit.) | | Boiling point | 436.98°C (rough estimate) | | density | 1.2393 (rough estimate) | | refractive index | 1.4365 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.48±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 24.0±1°, c = 1% in ethanol | | BRN | 2567599 | | Major Application | peptide synthesis | | InChI | 1S/C14H17NO6/c1-20-13(18)11(7-8-12(16)17)15-14(19)21-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,19)(H,16,17)/t11-/m0/s1 | | InChIKey | BGMCTGARFXPQML-NSHDSACASA-N | | SMILES | COC(=O)[C@H](CCC(O)=O)NC(=O)OCc1ccccc1 | | CAS DataBase Reference | 5672-83-3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Z-GLU-OME Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder or crystals | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-GLU-OME Preparation Products And Raw materials |
|