|
|
| | 2-Chloro-4-nitoranisole Basic information |
| | 2-Chloro-4-nitoranisole Chemical Properties |
| Melting point | 94 °C | | Boiling point | 286.6±20.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H6ClNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 | | InChIKey | DLJPNXLHWMRQIQ-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C([N+]([O-])=O)C=C1Cl | | CAS DataBase Reference | 4920-79-0 | | NIST Chemistry Reference | Benzene, 2-chloro-1-methoxy-4-nitro-(4920-79-0) |
| Hazard Codes | Xi | | RTECS | BZ8578000 | | HS Code | 2909.30.6000 | | HazardClass | IRRITANT |
| | 2-Chloro-4-nitoranisole Usage And Synthesis |
| Uses | 2-Chloro-4-nitoranisole can be used as pharmaceutical intermediate |
| | 2-Chloro-4-nitoranisole Preparation Products And Raw materials |
|