- ACLONIFEN
-
- $0.00 / 25KG
-
2025-12-01
- CAS:740470-46-5
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- ACLONIFEN
-
- $0.00 / 1KG
-
2025-06-27
- CAS:74070-46-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | ACLONIFEN Basic information |
| Product Name: | ACLONIFEN | | Synonyms: | 2-chloro-6-nitro-3-phenoxy-benzenamin;2-chloro-6-nitro-3-phenoxybenzenamine;bandur;2-CHLORO-6-NITRO-3-PHENOXY-ANILINE;ACLONIFEN;ACLONIFEN PESTANAL (2-CHLORO-6-NI- TRO-3;CHALLENGE;2-chloro-6-nitri-3-phenoxyaniline | | CAS: | 74070-46-5 | | MF: | C12H9ClN2O3 | | MW: | 264.66 | | EINECS: | 277-704-1 | | Product Categories: | | | Mol File: | 74070-46-5.mol |  |
| | ACLONIFEN Chemical Properties |
| Melting point | 81.5 °C | | Boiling point | 361.5±42.0 °C(Predicted) | | density | 1.4257 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -3.15±0.25(Predicted) | | color | Light yellow to Yellow to Orange | | BRN | 8321574 | | Major Application | agriculture
environmental | | InChI | InChI=1S/C12H9ClN2O3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17/h1-7H,14H2 | | InChIKey | DDBMQDADIHOWIC-UHFFFAOYSA-N | | SMILES | C1(N)=C([N+]([O-])=O)C=CC(OC2=CC=CC=C2)=C1Cl | | LogP | 4.040 | | EPA Substance Registry System | Aclonifen (74070-46-5) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | RTECS | CX9858650 | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Skin Sens. 1A |
| | ACLONIFEN Usage And Synthesis |
| Uses | Aclonifen is used as a pesticide and herbicide. | | Definition | ChEBI: Aclonifen is a primary amino compound that is aniline in which the phenyl group has been substituted at positions 2, 3, and 6 by chlorine, phenoxy, and nitro groups, respectively. A protoporphyrinogen oxidase (PPO) inhibitor, it is used as a herbicide against a broad range of weeds in a wide range of crops. It has a role as a herbicide, an agrochemical, an EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor and a carotenoid biosynthesis inhibitor. It is a member of monochlorobenzenes, an aromatic ether, a C-nitro compound, a substituted aniline and a primary amino compound. |
| | ACLONIFEN Preparation Products And Raw materials |
|