|
|
| | Tris(trimethylsilyloxy)ethylene Basic information |
| | Tris(trimethylsilyloxy)ethylene Chemical Properties |
| Boiling point | 54-56 °C/0.1 mmHg (lit.) | | density | 0.886 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.420(lit.) | | Fp | 103 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 0.885 | | Water Solubility | Insoluble | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1962905 | | InChI | InChI=1S/C11H28O3Si3/c1-15(2,3)12-10-11(13-16(4,5)6)14-17(7,8)9/h10H,1-9H3 | | InChIKey | FCZGHPGTZRTDNN-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)O/C(/O[Si](C)(C)C)=C/O[Si](C)(C)C | | CAS DataBase Reference | 69097-20-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-10 | | Safety Statements | 26-36-37/39-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | Tris(trimethylsilyloxy)ethylene Usage And Synthesis |
| Chemical Properties | clear colorless to yellowish liquid | | Uses | Tris(trimethylsiloxy)ethylene has been used in:
- stereospecific synthesis of insecticide ajuqarin-IV
- microwave-assisted synthesis of 2-hydroxy-1-phenylethanone
| | Preparation | Tris(trimethylsilyloxy)ethylene is prepared from the bis(trimethylsilyl) derivative of glycolic acid by either forming the enolate with Lithium
Hexamethyldisilazide at -78 °C in THF and trapping with Chlorotrimethylsilane, or by the reaction with Trimethylsilyl
Trifluoromethanesulfonate and Triethylamine at rt (eq 1).
 | | storage | Tris(trimethylsilyloxy)ethylene is readily hydrolyzed in protic solvents. It should be stored in a sealed container protected
from the atmosphere. Since the reaction of the reagent with carboxylic acid chlorides and aldehydes under Lewis acid catalysis in
the absence of solvent is highly exothermic, large-scale preparations may require regulation of the reaction temperature either by
external cooling or by controlled addition of the reactants. |
| | Tris(trimethylsilyloxy)ethylene Preparation Products And Raw materials |
|