|
|
| | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine Basic information |
| Product Name: | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine | | Synonyms: | 2,4,6-tris(trifluoromethyl)-s-triazin;2,4,6-Tris(trifluoromethyl)-s-triazine;s-Triazine, 2,4,6-tris(trifluoromethyl)-;TTT;TRIS(TRIFLUOROMETHYL)-1,3,5-TRIAZINE;TRIS(TRIFLUOROMETHYL)-S-TRIAZINE;2,4,6-TRIS(TRIFLUOROMETHYL)-1,3,5-TRIAZINE;LABOTEST-BB LT00451669 | | CAS: | 368-66-1 | | MF: | C6F9N3 | | MW: | 285.07 | | EINECS: | 206-709-3 | | Product Categories: | Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 368-66-1.mol |  |
| | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine Chemical Properties |
| Melting point | -24.7°C | | Boiling point | 98.3-98.5 °C/748 mmHg (lit.) | | density | 1.596 g/mL at 25 °C | | refractive index | n20/D 1.313(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | -4.88±0.10(Predicted) | | form | Liquid | | color | Clear colorless | | BRN | 302339 | | Stability: | Volatile | | InChI | 1S/C6F9N3/c7-4(8,9)1-16-2(5(10,11)12)18-3(17-1)6(13,14)15 | | InChIKey | LSGBKABSSSIRJF-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1nc(nc(n1)C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 368-66-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,5-Triazine, 2,4,6-tris(trifluoromethyl)-(368-66-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37-36/37/38 | | Safety Statements | 26-36-36/37/39 | | RIDADR | UN 2810 6.1/PG 2 | | WGK Germany | 3 | | RTECS | XZ2800000 | | F | 1-10 | | HazardClass | IRRITANT | | HS Code | 29336980 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
STOT SE 3 |
| | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine is used as a secondary battery electrolyte in power storage systems. | | Synthesis Reference(s) | Journal of the American Chemical Society, 72, p. 3527, 1950 DOI: 10.1021/ja01164a056 |
| | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine Preparation Products And Raw materials |
|