|
|
| | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE Basic information |
| Product Name: | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE | | Synonyms: | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE;2,3,4,6-TETRA-O-BENZYL-D-MANNOPYRANOSE;2,3,4,6-TETRA-O-BENZYL-D-MANNOPYRANOSIDE;2,3,4,6-TETRA-O-BENZYL-A-D-MANNOSE;2,3,4,6-TETRA-O-BENZYL-A-D-MANNOPYRANOSE;2,3,4,5-Tetra-O-benzyl-a-D-mannopyranose;2,3,4,6-Tetra-O-benzyl-D-mannopyranose ,98%;2,3,4,6-Tetrakis-O-(phenylMethyl)-D-Mannose | | CAS: | 61330-61-8 | | MF: | C34H36O6 | | MW: | 540.65 | | EINECS: | | | Product Categories: | Aromatics;13C & 2H Sugars;aldehydes;Carbohydrates & Derivatives;Glycon Biochem | | Mol File: | 61330-61-8.mol |  |
| | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE Chemical Properties |
| Boiling point | 240-245°C | | density | 1.179±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.33±0.20(Predicted) | | form | Oil | | color | Colorless to Light Yellow | | Stability: | Freezer | | InChIKey | OUHUDRYCYOSXDI-YFRBGRBWSA-N | | SMILES | O=C[C@H]([C@H]([C@@H]([C@@H](COCC1=CC=CC=C1)O)OCC1=CC=CC=C1)OCC1=CC=CC=C1)OCC1=CC=CC=C1 | | CAS DataBase Reference | 61330-61-8(CAS DataBase Reference) |
| | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose (cas# 61330-61-8) is a compound useful in organic synthesis. |
| | 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-MANNOPYRANOSE Preparation Products And Raw materials |
|