| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine Basic information |
| Product Name: | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine | | Synonyms: | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine, 98%;(1S,2S)-1,2-Bis(4-methoxyphenyl)-1,2-ethanediamine dihydrochloride;(1S,2S)-1,2-Bis(4-methoxyphenyl)ethylenediamine dihydrochloride;S)-DAEN;(1S,2S)-1,2-Bis(4-methoxyphenyl)ethane-1,2-diamine,99%e.e.;1R,2R-1,2-Di(4'-methoxyphenyl)-1,2-diaminoethan;1,?2-?Ethanediamine, 1,?2-?bis(4-?methoxyphenyl)?-?, (1S,?2S)?-;(1S,2S)-Bis(4-methoxyphenyL | | CAS: | 58520-04-0 | | MF: | C16H20N2O2 | | MW: | 272.34 | | EINECS: | 227-186-8 | | Product Categories: | | | Mol File: | 58520-04-0.mol |  |
| | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine Chemical Properties |
| Melting point | 89-91°C | | Boiling point | 438.2±45.0 °C(Predicted) | | density | 1.135±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.21±0.10(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Air Sensitive | | InChI | InChI=1S/C16H20N2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15-16H,17-18H2,1-2H3/t15-,16-/m0/s1 | | InChIKey | ZWMPRHYHRAUVGY-HOTGVXAUSA-N | | SMILES | [C@@H](C1=CC=C(OC)C=C1)(N)[C@H](C1=CC=C(OC)C=C1)N | | CAS DataBase Reference | 58520-04-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37 |
| | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine Usage And Synthesis |
| | (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine Preparation Products And Raw materials |
|