| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine Basic information |
| Product Name: | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine | | Synonyms: | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine;(1R,2R)-1,2-Diamino-1,2-bis(4-methoxyphenyl)ethane;(1R,2R)-Bis(4-methoxyphenyl)-1;(1R,2R)-Bis(4-methoxyphenyl)-1,2-ethanediamine, 98%;2-[3-(carboxymethyl)-2,2-dimethylcyclohexyl]acetic acid;2-[3-(carboxymethyl)-2,2-dimethyl-cyclohexyl]acetic acid;2-[3-(carboxymethyl)-2,2-dimethyl-cyclohexyl]ethanoic acid;1,2-Bis(4-methoxyphenyl)ethane-1,1-diamine | | CAS: | 58520-03-9 | | MF: | C16H20N2O2 | | MW: | 272.34 | | EINECS: | | | Product Categories: | Amines (Chiral);Chiral Building Blocks;Synthetic Organic Chemistry | | Mol File: | 58520-03-9.mol |  |
| | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine Chemical Properties |
| Melting point | 90 °C | | Boiling point | 438.2±45.0 °C(Predicted) | | density | 1.135±0.06 g/cm3(Predicted) | | refractive index | 116 ° (C=1, MeOH) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.21±0.10(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Air Sensitive | | InChI | InChI=1S/C16H20N2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15-16H,17-18H2,1-2H3/t15-,16-/m1/s1 | | InChIKey | ZWMPRHYHRAUVGY-HZPDHXFCSA-N | | SMILES | [C@H](C1=CC=C(OC)C=C1)(N)[C@@H](C1=CC=C(OC)C=C1)N | | CAS DataBase Reference | 58520-03-9(CAS DataBase Reference) |
| | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine Usage And Synthesis |
| | (1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine Preparation Products And Raw materials |
|