|
|
| | HEXYL-BETA-D-GLUCOPYRANOSIDE Basic information |
| | HEXYL-BETA-D-GLUCOPYRANOSIDE Chemical Properties |
| Melting point | 84-86°C | | Boiling point | 432.3±45.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone, Ethanol, Water | | pka | 12.96±0.70(Predicted) | | form | Solid | | color | White Crystalline | | Optical Rotation | [α]20/D 33±2°, c = 5% in H2O | | BRN | 83239 | | InChI | 1S/C12H24O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11-,12-/m1/s1 | | InChIKey | JVAZJLFFSJARQM-RMPHRYRLSA-N | | SMILES | CCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | | CAS DataBase Reference | 59080-45-4(CAS DataBase Reference) |
| | HEXYL-BETA-D-GLUCOPYRANOSIDE Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A mild nonionic detergent. | | Synthesis | In standard synthesis experiments, (2R,3R,4S,5S,6R)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol and n-hexanol were used as starting materials for the preparation of the target compound (CAS:39824-11-8). This was done as follows: first, 18 mL of tertiary alcohol was mixed with 2 mL of aqueous solution containing 0.25 mol/L glucose as reaction medium. Subsequently, 60 mg of almond powder was added to the mixture as a catalyst. The reaction system was transferred to a 100 mL round-bottomed flask and the reaction was carried out in a constant temperature water bath at 50 °C with continuous oscillation at 180 r/min. During the reaction, 50 μL was sampled periodically and the reaction progress was monitored by high performance liquid chromatography (HPLC). For the synthesis of methyl-D-glucoside, 2 mL of methanol, 16 mL of acetonitrile mixed with 2 mL of aqueous solution containing 0.25 mol/L glucose was required as the reaction system. | | References | [1] Chinese Journal of Catalysis, 2012, vol. 33, # 2-3, p. 275 - 280 |
| | HEXYL-BETA-D-GLUCOPYRANOSIDE Preparation Products And Raw materials |
|