| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate manufacturers
|
| | Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate Basic information |
| Product Name: | Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate | | Synonyms: | [BIS-(2,2,2-TRIFLUORO-ETHOXY)-PHOSPHORYL]-ACETIC ACID METHYL ESTER;Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate 97%;Di(3,3,3-trifluoroethyl)(ethoxycarbonylmethyl)phosphonate;[Bis-(2,2,2-trifluoro-ethoxy)-phosphoryl]-acetic acid ethyl ester;Acetic acid, 2-[bis(2,2,2-trifluoroethoxy)phosphinyl]-, ethyl ester;Ethyl 2-[bis(2,2,2-trifluoroethoxy)phosphinyl]acetate;Ethyl 2-(bis(2,2,2-trifluoroethoxy)phosphoryl)acetate;Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate | | CAS: | 124755-24-4 | | MF: | C8H11F6O5P | | MW: | 332.13 | | EINECS: | | | Product Categories: | Organic Building Blocks;Phosphonates/Phosphinates;Phosphorus Compounds | | Mol File: | 124755-24-4.mol | ![Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate Structure](CAS/GIF/124755-24-4.gif) |
| | Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate Chemical Properties |
| Boiling point | 249-250 °C(lit.) | | density | 1.403 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3730(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H11F6O5P/c1-2-17-6(15)3-20(16,18-4-7(9,10)11)19-5-8(12,13)14/h2-5H2,1H3 | | InChIKey | HBYHPBCAZBLFTD-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CP(OCC(F)(F)F)(OCC(F)(F)F)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate Usage And Synthesis |
| Uses | Ethyl [Bis(2,2,2-trifluoroethoxy)phosphinyl]acetate is a reagent used in the preparation of spiroketal EBC-23; an anticancer agent, scytonemin A; a novel calcium antagonist and other useful organic compounds. | | Synthesis | To stirred solution of 18-crown-6 (4.40 g, 16.65 mmol), THF (20 mL), and bis
(2,2,2-trifluoroethyl) phosphite (1) (0.55 mL, 3.75 mmol), KHMDS (8.0 mL, 4.00 mmol,
0.5 M in toluene) was added via syringe in a dropwise manner at -78 oC. Ethyl
chloroacetate (0.35 mL, 3.30 mmol) was added to the flask after 15 min. The reaction
flask was allowed to warm to room temperature and stir for 4 hr. After standard workup
procedure, the crude product was then purified by flash column chromatography (2:1-1:1
hexanes:EtOAc, Rf
= 0.25 in 2:1 hexanes:EtOAc) yielding Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate (808 mg,
2.43 mmol, 73.4%) as a yellow syrup. |
| | Ethyl [bis(2,2,2-trifluoroethoxy)phosphinyl]acetate Preparation Products And Raw materials |
|