| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-[(2,6-Diethylphenyl)(butoxymethyl)amino]-2-oxo-ethanesulfonic acid sodium salt Basic information |
| | 2-[(2,6-Diethylphenyl)(butoxymethyl)amino]-2-oxo-ethanesulfonic acid sodium salt Chemical Properties |
| Melting point | 181-184oC | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | color | Off-White | | Major Application | agriculture
environmental | | InChI | 1S/C17H27NO5S.Na/c1-4-7-11-23-13-18(16(19)12-24(20,21)22)17-14(5-2)9-8-10-15(17)6-3;/h8-10H,4-7,11-13H2,1-3H3,(H,20,21,22);/q;+1/p-1 | | InChIKey | KNWWTVNLPSYRSP-UHFFFAOYSA-M | | SMILES | [Na+].CCCCOCN(C(=O)CS([O-])(=O)=O)c1c(CC)cccc1CC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-[(2,6-Diethylphenyl)(butoxymethyl)amino]-2-oxo-ethanesulfonic acid sodium salt Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | Definition | ChEBI: Butachlor ESA sodium salt is an anilide. |
| | 2-[(2,6-Diethylphenyl)(butoxymethyl)amino]-2-oxo-ethanesulfonic acid sodium salt Preparation Products And Raw materials |
|