| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 4-[2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]-phenol hydrochloride Basic information |
| | 4-[2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]-phenol hydrochloride Chemical Properties |
| Melting point | >75°C (dec.) | | storage temp. | 2-8°C | | solubility | DMSO: >20mg/mL | | form | powder | | color | white to off-white | | Stability: | Hygroscopic | | InChI | 1S/C16H25NO2.ClH/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16;/h6-9,15,18-19H,3-5,10-12H2,1-2H3;1H | | InChIKey | IMWPSXHIEURNKZ-UHFFFAOYSA-N | | SMILES | Cl.CN(C)CC(c1ccc(O)cc1)C2(O)CCCCC2 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-[2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]-phenol hydrochloride Usage And Synthesis |
| Uses | Desvenlafaxine Hydrochloride is a major active metabolite of venlafaxine (V120000), which is a slective serotonin noradrenaline reuptake inhibitor and used as an antidepressant. | | Uses | Desvenlafaxine hydrochloride has been used to evaluate if its occurrence in drinking water at environmental concentrations could induce neuronal gene expression. | | Biochem/physiol Actions | Desvenlafaxine hydrochloride is a dual SERT/NET reuptake inhibitor. It is a major active metabolite of venlafaxine (#542); brain penetrant; Ki = 40 nM and 122 nM for hSERT and hNET, respectively (weak binding at the hDAT). Inhibition of [3H]5-HT or [3H]NE uptake for the hSERT or hNET produced IC50 values of 47 and 531 nM. |
| | 4-[2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]-phenol hydrochloride Preparation Products And Raw materials |
|