- cobalt(2+),5,10,15,20-tetraphenyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide
-
- $9.80
-
2020-01-01
- CAS:14172-90-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | COBALT TPP Basic information |
| Product Name: | COBALT TPP | | Synonyms: | PROTOPORPHYRIN IX CO (II);(Tetraphenylporphinato)cobalt;21H,23H-Porphine, 5,10,15,20-tetraphenyl-, cobalt complex;alpha,beta,gamma,delta-Tetraphenylporphinatocobalt(II);Cobalt meso-tetraphenylporphyrin;Cobalt(2+) tetraphenylporphinate;Cobalt(II) alpha,beta,gamma,delta-tetraphenylporphine;Cobalt, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N(21)-,N(22)-,N(23)-,N(24)-]-, (SP-4-1)- | | CAS: | 14172-90-8 | | MF: | C44H28CoN4 | | MW: | 671.65 | | EINECS: | 238-018-8 | | Product Categories: | Cobalt Salts;Materials Science;Metal and Ceramic Science;Salts;metal porphine (porphyrin) complex | | Mol File: | 14172-90-8.mol |  |
| | COBALT TPP Chemical Properties |
| Melting point | >300 °C (dec.) | | density | 1.20 g/cm3 | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | rust colored | | λmax | 528nm(CH2Cl2)(lit.) | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChIKey | LSZLYWSRWXFMOI-DAJBKUBHSA-N | | SMILES | N12[Co]N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:7,14,41,t:36| | | CAS DataBase Reference | 14172-90-8 |
| WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | COBALT TPP Usage And Synthesis |
| Chemical Properties | brown crystals or powder | | Uses | Co(II) meso-Tetraphenylporphine is used in the decomposition of substituted cycloheptatriene endoperoxides. | | Purification Methods | It yields brown crystals from Et2O or CHCl3/MeOH (cf iron chloride complex). It crystallises on extraction (Soxhlet) with *C6H6. It is soluble in most organic solvents except MeOH and pet ether. [UV, IR: Rothemund & Manott J Am Chem Soc 70 1808 1948, Thomas & Martell J Am Chem Soc 81 5111 1959.] |
| | COBALT TPP Preparation Products And Raw materials |
|