|
|
| | Cefquinome Basic information |
| Product Name: | Cefquinome | | Synonyms: | cefquinome;1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt;7-[[2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetyl]amino]-3-[[(5,6,7,8-tetrahydroquinolinium)-1-yl]methyl]cepham-3-ene-4-carboxylate;HR-111V;CefquinomeQ: What is
Cefquinome Q: What is the CAS Number of
Cefquinome Q: What is the storage condition of
Cefquinome;(6R,7R)-7-{[(2Z)-2-(2-Amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-3-(5,6,7,8-tetrahydro-1-quinoliniumylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;Cefotaxime Impurity 58;Cefquinoxime | | CAS: | 84957-30-2 | | MF: | C23H24N6O5S2 | | MW: | 528.6 | | EINECS: | | | Product Categories: | | | Mol File: | 84957-30-2.mol |  |
| | Cefquinome Chemical Properties |
| Melting point | >160°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChIKey | YWKJNRNSJKEFMK-YYMYJTJINA-N | | SMILES | C(C1=C(CS[C@]2([H])[C@H](NC(=O)/C(/C3=CSC(N)=N3)=N\OC)C(=O)N12)C[N+]1=CC=CC2CCCCC1=2)(=O)[O-] |&1:5,7,r| |
| | Cefquinome Usage And Synthesis |
| Chemical Properties | White to pale yellow crystalline powder | | Uses | Antibacterial
(veterinary). | | Uses | Cefquinome (cas# 84957-30-2) is a compound useful in organic synthesis. |
| | Cefquinome Preparation Products And Raw materials |
|