|
|
| | Di-tert-butyl N,N-diethylphosphoramidite Basic information |
| Product Name: | Di-tert-butyl N,N-diethylphosphoramidite | | Synonyms: | DI-T-BUTYL N,N-DIETHYLPHOSPHORAMIDITE;DI-TERT-BUTYL N,N-DIETHYLPHOSPHORAMIDITE;DI-TERT-BUTYL-N,N-DIETHYLPHOSPHOROAMIDITE;DI-TERT-BUTYL DIETHYLPHOSPHORAMIDITE, TE CH., 93%;Diethyl diethylphosphoramidite;N,N-Diethyl-phosphoraMidous Acid Bis(1,1-diMethylethyl) Ester;Phosphoramidous acid, diethyl-, bis(1,1-dimethylethyl) ester;Di-tert-butyl N,N-diethylphosphoraMidit | | CAS: | 117924-33-1 | | MF: | C12H28NO2P | | MW: | 249.33 | | EINECS: | | | Product Categories: | Phospholipids - 13C & 2H;Regant series;Phosphorylating and Phosphitylating Agents;Organic Building Blocks;Phosphoramidites;Phosphorus Compounds;Building Blocks;Chemical Synthesis;Organic Building Blocks;Phosphorus Compounds;OLED materials,pharm chemical,electronic | | Mol File: | 117924-33-1.mol |  |
| | Di-tert-butyl N,N-diethylphosphoramidite Chemical Properties |
| Boiling point | 39-41 °C/0.3 mmHg (lit.) | | density | 0.896 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.434(lit.) | | Fp | 173 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 4.41±0.70(Predicted) | | form | Oil | | color | Clear Colourless | | Water Solubility | Hydrolyzes in water. Soluble in chloroform and methanol. | | Sensitive | Moisture Sensitive | | BRN | 4175262 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C12H28NO2P/c1-9-13(10-2)16(14-11(3,4)5)15-12(6,7)8/h9-10H2,1-8H3 | | InChIKey | KUKSUQKELVOKBH-UHFFFAOYSA-N | | SMILES | P(N(CC)CC)(OC(C)(C)C)OC(C)(C)C | | CAS DataBase Reference | 117924-33-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 4.4-10-21 | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Di-tert-butyl N,N-diethylphosphoramidite Usage And Synthesis |
| Chemical Properties | Clear Colourless Liquid | | Uses | A useful reagent for the efficient phosphorylative conversion of alcohols into their corresponding dibenzylphosphorotriesters. It is applied as a phosphitylating agent in water-soluble phosphate prodrugs of 1-propargyl-8-styrylxanthine derivatives, a2a-selective adenosine receptor antagonists. | | Uses | Di-tert-butyl N,N-diethylphosphoramidite is a useful reagent for the efficient phosphorylative conversion of alcohols into their corresponding dibenzylphosphorotriesters. |
| | Di-tert-butyl N,N-diethylphosphoramidite Preparation Products And Raw materials |
|