| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid Basic information |
| Product Name: | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid | | Synonyms: | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid 98%;4-(1,1,2,2-Tetrafluoroethoxy)benzoicacid98%;RARECHEM AL BE 0275;4-(1,1,2,2-Tetrafluoroethoxy)benzoid Acid;(1,1,2,2-Tetrafluoroethoxy) Benzoate;4-(1,1,2,2-Tetrafluoroethoxy)benzoicacid97%;Benzoic acid,4-(1,1,2,2-tetrafluoroethoxy)-;(1S,2R)-N-BENZYL-2-AMINO-1,78-DIPHENYLETHANOL | | CAS: | 10009-25-3 | | MF: | C9H6F4O3 | | MW: | 238.14 | | EINECS: | | | Product Categories: | Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;C9;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 10009-25-3.mol |  |
| | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid Chemical Properties |
| Melting point | 175-179 °C (lit.) | | Boiling point | 275.3±40.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | pka | 3.95±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | 1S/C9H6F4O3/c10-8(11)9(12,13)16-6-3-1-5(2-4-6)7(14)15/h1-4,8H,(H,14,15) | | InChIKey | SVGWTILJZWYEMD-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(OC(F)(F)C(F)F)cc1 | | CAS DataBase Reference | 10009-25-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | CORROSIVE | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid Usage And Synthesis |
| | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid Preparation Products And Raw materials |
|